![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Static Routing Übung.pkt | 2025-02-25 15:15 | 43K | |
| Übung Stat. Routen IPv4_finish.pdf | 2025-02-25 15:15 | 112K | |
| 2.2.4.4 Packet Tracer - Configuring IPv6 Static and Default Routes_finish.pka | 2025-02-25 15:15 | 399K | |
| Routing-Praxis.pdf | 2025-02-25 15:15 | 108K | |
| Routing-Praxis.xopp | 2025-02-25 15:15 | 3.2K | |
| Static Routing Übung_finish.pkt | 2025-02-25 15:15 | 52K | |
| 2.2.5.5 Packet Tracer - Configuring Floating Static Routes_finish.pka | 2025-02-25 15:15 | 475K | |
| 3.6.1-packet-tracer---implement-vlans-and-trunking.pka | 2025-02-25 15:15 | 699K | |
| 2.2.5.5 Packet Tracer - Configuring Floating Static Routes.pka | 2025-02-25 15:15 | 344K | |
| Übung Stat. Routen IPv4.xopp | 2025-02-25 15:15 | 6.6K | |
| Übung Stat. Routen IPv4.pdf | 2025-02-25 15:15 | 420K | |
| VLAN Grundlagen.pdf | 2025-02-25 15:15 | 120K | |
| VLAN.pdf | 2025-02-25 15:15 | 469K | |
| InterVLAN-Routing mit L3-Switch.pdf | 2025-02-25 15:15 | 177K | |
| 2.2.5.5 pakettracer | 2025-02-25 15:15 | 114 | |
| 2.2.4.4 Packet Tracer - Configuring IPv6 Static and Default Routes.pka | 2025-02-25 15:15 | 295K | |